C10H11F5O3 — CID 162565456
2-methoxy-5-(2,2,3,3,3-pentafluoropropyl)cyclohexa-1,3-diene-1,4-diol (PubChem CID 162565456) has the molecular formula C10H11F5O3 and a molecular weight of 274.19 g/mol. Its IUPAC name is 2-methoxy-5-(2,2,3,3,3-pentafluoropropyl)cyclohexa-1,3-diene-1,4-diol.
| Compound Name | 2-methoxy-5-(2,2,3,3,3-pentafluoropropyl)cyclohexa-1,3-diene-1,4-diol |
|---|---|
| PubChem CID | 162565456 |
| Molecular Formula | C10H11F5O3 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-methoxy-5-(2,2,3,3,3-pentafluoropropyl)cyclohexa-1,3-diene-1,4-diol |
| SMILES | COC1=C(O)CC(CC(F)(F)C(F)(F)F)C(O)=C1 |
| InChI | InChI=1S/C10H11F5O3/c1-18-8-3-6(16)5(2-7(8)17)4-9(11,12)10(13,14)15/h3,5,16-17H,2,4H2,1H3 |
| InChIKey | KOEYAHWKILDCBQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|