C31H15F6NO7 — CID 162565507
5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]isoindole-1,3-dione (PubChem CID 162565507) has the molecular formula C31H15F6NO7 and a molecular weight of 627.45 g/mol. Its IUPAC name is 5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]isoindole-1,3-dione.
| Compound Name | 5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162565507 |
| Molecular Formula | C31H15F6NO7 |
| Molecular Weight | 627.45 g/mol |
| Exact Mass | 627.08 |
| IUPAC Name | 5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(Oc3ccc(C(c4ccc(Oc5ccc6c(c5)C(=O)OC6=O)cc4)(C(F)(F)F)C(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C31H15F6NO7/c32-30(33,34)29(31(35,36)37,15-1-5-17(6-2-15)43-19-9-11-21-23(13-19)26(40)38-25(21)39)16-3-7-18(8-4-16)44-20-10-12-22-24(14-20)28(42)45-27(22)41/h1-14H,(H,38,39,40) |
| InChIKey | KWIZNUDDOSGASJ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.45 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|