C13H15F4N3O — CID 162565563
5-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)cyclohex-3-en-1-yl]ethenyl]-1H-1,2,4-triazole (PubChem CID 162565563) has the molecular formula C13H15F4N3O and a molecular weight of 305.28 g/mol. Its IUPAC name is 5-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)cyclohex-3-en-1-yl]ethenyl]-1H-1,2,4-triazole.
| Compound Name | 5-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)cyclohex-3-en-1-yl]ethenyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 162565563 |
| Molecular Formula | C13H15F4N3O |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-[(E)-2-[4-(2,2,3,3-tetrafluoropropoxy)cyclohex-3-en-1-yl]ethenyl]-1H-1,2,4-triazole |
| SMILES | FC(F)C(F)(F)COC1=CCC(/C=C/c2ncn[nH]2)CC1 |
| InChI | InChI=1S/C13H15F4N3O/c14-12(15)13(16,17)7-21-10-4-1-9(2-5-10)3-6-11-18-8-19-20-11/h3-4,6,8-9,12H,1-2,5,7H2,(H,18,19,20)/b6-3+ |
| InChIKey | CDWDHYOLHFPFAR-ZZXKWVIFSA-N |
| XLogP | 3.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|