About 1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea
1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea (PubChem CID 162565633) has the molecular formula C13H18F3N3S2
and a molecular weight of 337.44 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea.
Molecular Properties
| Compound Name | 1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea |
| PubChem CID | 162565633 |
| Molecular Formula | C13H18F3N3S2 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea |
| SMILES | FC(F)(F)c1csc(NC(=S)NCCC2CCCCC2)n1 |
| InChI | InChI=1S/C13H18F3N3S2/c14-13(15,16)10-8-21-12(18-10)19-11(20)17-7-6-9-4-2-1-3-5-9/h8-9H,1-7H2,(H2,17,18,19,20) |
| InChIKey | CUEHKVAZXZZMBJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea?
The IUPAC name of 1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea (CID 162565633) is 1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea.
What is the SMILES notation for 1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea?
The canonical SMILES for 1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea is FC(F)(F)c1csc(NC(=S)NCCC2CCCCC2)n1.
What is the InChIKey of 1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea?
The InChIKey is CUEHKVAZXZZMBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F3N3S2/c14-13(15,16)10-8-21-12(18-10)19-11(20)17-7-6-9-4-2-1-3-5-9/h8-9H,1-7H2,(H2,17,18,19,20).
What are the key properties of 1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea?
1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea has a molecular weight of 337.44 g/mol, XLogP of 4.42, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclohexylethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]thiourea is sourced from PubChem (CID 162565633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).