About [2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine
[2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine (PubChem CID 162566234) has the molecular formula C10H16F2N2
and a molecular weight of 202.25 g/mol. Its IUPAC name is [2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine.
Molecular Properties
| Compound Name | [2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine |
| PubChem CID | 162566234 |
| Molecular Formula | C10H16F2N2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | [2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine |
| SMILES | CC(F)(F)CCC1CC=C(CN)C=N1 |
| InChI | InChI=1S/C10H16F2N2/c1-10(11,12)5-4-9-3-2-8(6-13)7-14-9/h2,7,9H,3-6,13H2,1H3 |
| InChIKey | GEGAGFLZMVSERX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine?
The IUPAC name of [2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine (CID 162566234) is [2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine.
What is the SMILES notation for [2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine?
The canonical SMILES for [2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine is CC(F)(F)CCC1CC=C(CN)C=N1.
What is the InChIKey of [2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine?
The InChIKey is GEGAGFLZMVSERX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2N2/c1-10(11,12)5-4-9-3-2-8(6-13)7-14-9/h2,7,9H,3-6,13H2,1H3.
What are the key properties of [2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine?
[2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine has a molecular weight of 202.25 g/mol, XLogP of 2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,3-difluorobutyl)-2,3-dihydropyridin-5-yl]methanamine is sourced from PubChem (CID 162566234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).