C19H21F2N5O3 — CID 162566306
2-acetamido-N-[[6-(2,2-difluoro-3-methylbut-3-enoxy)-3-pyridinyl]methyl]-6-methylpyrimidine-4-carboxamide (PubChem CID 162566306) has the molecular formula C19H21F2N5O3 and a molecular weight of 405.41 g/mol. Its IUPAC name is 2-acetamido-N-[[6-(2,2-difluoro-3-methylbut-3-enoxy)-3-pyridinyl]methyl]-6-methylpyrimidine-4-carboxamide.
| Compound Name | 2-acetamido-N-[[6-(2,2-difluoro-3-methylbut-3-enoxy)-3-pyridinyl]methyl]-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 162566306 |
| Molecular Formula | C19H21F2N5O3 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-acetamido-N-[[6-(2,2-difluoro-3-methylbut-3-enoxy)-3-pyridinyl]methyl]-6-methylpyrimidine-4-carboxamide |
| SMILES | C=C(C)C(F)(F)COc1ccc(CNC(=O)c2cc(C)nc(NC(C)=O)n2)cn1 |
| InChI | InChI=1S/C19H21F2N5O3/c1-11(2)19(20,21)10-29-16-6-5-14(8-22-16)9-23-17(28)15-7-12(3)24-18(26-15)25-13(4)27/h5-8H,1,9-10H2,2-4H3,(H,23,28)(H,24,25,26,27) |
| InChIKey | QBVFMJOSHDFYEV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|