About [5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine
[5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine (PubChem CID 162566363) has the molecular formula C8H9F4NO
and a molecular weight of 211.16 g/mol. Its IUPAC name is [5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine.
Molecular Properties
| Compound Name | [5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine |
| PubChem CID | 162566363 |
| Molecular Formula | C8H9F4NO |
| Molecular Weight | 211.16 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | [5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine |
| SMILES | NCC1C=CC(OC(F)(F)F)=C(F)C1 |
| InChI | InChI=1S/C8H9F4NO/c9-6-3-5(4-13)1-2-7(6)14-8(10,11)12/h1-2,5H,3-4,13H2 |
| InChIKey | JFFRILZNZLCGGP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine?
The IUPAC name of [5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine (CID 162566363) is [5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine.
What is the SMILES notation for [5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine?
The canonical SMILES for [5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine is NCC1C=CC(OC(F)(F)F)=C(F)C1.
What is the InChIKey of [5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine?
The InChIKey is JFFRILZNZLCGGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F4NO/c9-6-3-5(4-13)1-2-7(6)14-8(10,11)12/h1-2,5H,3-4,13H2.
What are the key properties of [5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine?
[5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine has a molecular weight of 211.16 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-fluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]methanamine is sourced from PubChem (CID 162566363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).