C23H35F2NO3 — CID 162566734
methyl 7-[(5R)-5-[(E,3R,4S)-3,4-dimethylnon-1-en-6-ynyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoate (PubChem CID 162566734) has the molecular formula C23H35F2NO3 and a molecular weight of 411.53 g/mol. Its IUPAC name is methyl 7-[(5R)-5-[(E,3R,4S)-3,4-dimethylnon-1-en-6-ynyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[(5R)-5-[(E,3R,4S)-3,4-dimethylnon-1-en-6-ynyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 162566734 |
| Molecular Formula | C23H35F2NO3 |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | methyl 7-[(5R)-5-[(E,3R,4S)-3,4-dimethylnon-1-en-6-ynyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCC#CC[C@H](C)[C@@H](C)/C=C/[C@H]1CC(F)(F)C(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C23H35F2NO3/c1-5-6-9-12-18(2)19(3)14-15-20-17-23(24,25)22(28)26(20)16-11-8-7-10-13-21(27)29-4/h14-15,18-20H,5,7-8,10-13,16-17H2,1-4H3/b15-14+/t18-,19-,20-/m0/s1 |
| InChIKey | USNJABMHYXSMON-UGUMXLRLSA-N |
| XLogP | 4.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|