C18H20F5N3O2 — CID 162567104
(Z)-2-amino-N-[(2,6-difluorophenyl)methyl]-5,5,5-trifluoro-4-imino-N-[2-(oxolan-3-yl)ethyl]pent-2-enamide (PubChem CID 162567104) has the molecular formula C18H20F5N3O2 and a molecular weight of 405.37 g/mol. Its IUPAC name is (Z)-2-amino-N-[(2,6-difluorophenyl)methyl]-5,5,5-trifluoro-4-imino-N-[2-(oxolan-3-yl)ethyl]pent-2-enamide.
| Compound Name | (Z)-2-amino-N-[(2,6-difluorophenyl)methyl]-5,5,5-trifluoro-4-imino-N-[2-(oxolan-3-yl)ethyl]pent-2-enamide |
|---|---|
| PubChem CID | 162567104 |
| Molecular Formula | C18H20F5N3O2 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (Z)-2-amino-N-[(2,6-difluorophenyl)methyl]-5,5,5-trifluoro-4-imino-N-[2-(oxolan-3-yl)ethyl]pent-2-enamide |
| SMILES | [H]/N=C(/C=C(\N)C(=O)N(CCC1CCOC1)Cc1c(F)cccc1F)C(F)(F)F |
| InChI | InChI=1S/C18H20F5N3O2/c19-13-2-1-3-14(20)12(13)9-26(6-4-11-5-7-28-10-11)17(27)15(24)8-16(25)18(21,22)23/h1-3,8,11,25H,4-7,9-10,24H2/b15-8-,25-16- |
| InChIKey | OCXZWVYTRFJHRO-XOCQRVPZSA-N |
| XLogP | 3.14 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|