C7H4F10O — CID 162567259
1,2,2,3,3,4,4,5,5,6-decafluoro-6-methylcyclohexan-1-ol (PubChem CID 162567259) has the molecular formula C7H4F10O and a molecular weight of 294.09 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6-decafluoro-6-methylcyclohexan-1-ol.
| Compound Name | 1,2,2,3,3,4,4,5,5,6-decafluoro-6-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 162567259 |
| Molecular Formula | C7H4F10O |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6-decafluoro-6-methylcyclohexan-1-ol |
| SMILES | CC1(F)C(O)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7H4F10O/c1-2(8)3(9,10)4(11,12)5(13,14)6(15,16)7(2,17)18/h18H,1H3 |
| InChIKey | ODUXVGNSZTWOBZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|