About [9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate
[9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate (PubChem CID 162567959) has the molecular formula C20H16F4N2O5S
and a molecular weight of 472.42 g/mol. Its IUPAC name is [9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate |
| PubChem CID | 162567959 |
| Molecular Formula | C20H16F4N2O5S |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | [9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate |
| SMILES | CCN(CC)c1cc2oc3c4ccc(F)cc4[nH]c(=O)c3c2cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H16F4N2O5S/c1-3-26(4-2)14-9-15-12(8-16(14)31-32(28,29)20(22,23)24)17-18(30-15)11-6-5-10(21)7-13(11)25-19(17)27/h5-9H,3-4H2,1-2H3,(H,25,27) |
| InChIKey | QJMJSJNKHMQKDK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate?
The IUPAC name of [9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate (CID 162567959) is [9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate.
What is the SMILES notation for [9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate?
The canonical SMILES for [9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate is CCN(CC)c1cc2oc3c4ccc(F)cc4[nH]c(=O)c3c2cc1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate?
The InChIKey is QJMJSJNKHMQKDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F4N2O5S/c1-3-26(4-2)14-9-15-12(8-16(14)31-32(28,29)20(22,23)24)17-18(30-15)11-6-5-10(21)7-13(11)25-19(17)27/h5-9H,3-4H2,1-2H3,(H,25,27).
What are the key properties of [9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate?
[9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate has a molecular weight of 472.42 g/mol, XLogP of 4.64, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [9-(diethylamino)-3-fluoro-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-8-yl] trifluoromethanesulfonate is sourced from PubChem (CID 162567959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).