C27H24F8O4 — CID 162567964
3-[4-[2-but-3-enoxyethoxy(methoxy)methyl]-6-fluorocyclohexa-2,4-dien-1-ylidene]-6-[3,5-difluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-ylidene]-1,5-difluorocyclohexa-1,4-diene (PubChem CID 162567964) has the molecular formula C27H24F8O4 and a molecular weight of 564.47 g/mol. Its IUPAC name is 3-[4-[2-but-3-enoxyethoxy(methoxy)methyl]-6-fluorocyclohexa-2,4-dien-1-ylidene]-6-[3,5-difluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-ylidene]-1,5-difluorocyclohexa-1,4-diene.
| Compound Name | 3-[4-[2-but-3-enoxyethoxy(methoxy)methyl]-6-fluorocyclohexa-2,4-dien-1-ylidene]-6-[3,5-difluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-ylidene]-1,5-difluorocyclohexa-1,4-diene |
|---|---|
| PubChem CID | 162567964 |
| Molecular Formula | C27H24F8O4 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 3-[4-[2-but-3-enoxyethoxy(methoxy)methyl]-6-fluorocyclohexa-2,4-dien-1-ylidene]-6-[3,5-difluoro-4-(trifluoromethoxy)cyclohexa-2,4-dien-1-ylidene]-1,5-difluorocyclohexa-1,4-diene |
| SMILES | C=CCCOCCOC(OC)C1=CC(F)C(=c2cc(F)c(=C3C=C(F)C(OC(F)(F)F)=C(F)C3)c(F)c2)C=C1 |
| InChI | InChI=1S/C27H24F8O4/c1-3-4-7-37-8-9-38-26(36-2)15-5-6-18(19(28)10-15)16-11-20(29)24(21(30)12-16)17-13-22(31)25(23(32)14-17)39-27(33,34)35/h3,5-6,10-13,19,26H,1,4,7-9,14H2,2H3/b18-16-,24-17+ |
| InChIKey | YSVMFKPRXDZHTJ-PLWLMNJCSA-N |
| XLogP | 5.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|