C21H17F5N2O7S — CID 162568027
[(2R)-2-(2,5-difluoro-N-[4-(trifluoromethyl)phenyl]sulfonylanilino)propyl] (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 162568027) has the molecular formula C21H17F5N2O7S and a molecular weight of 536.43 g/mol. Its IUPAC name is [(2R)-2-(2,5-difluoro-N-[4-(trifluoromethyl)phenyl]sulfonylanilino)propyl] (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | [(2R)-2-(2,5-difluoro-N-[4-(trifluoromethyl)phenyl]sulfonylanilino)propyl] (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 162568027 |
| Molecular Formula | C21H17F5N2O7S |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | [(2R)-2-(2,5-difluoro-N-[4-(trifluoromethyl)phenyl]sulfonylanilino)propyl] (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | C[C@H](COC(=O)ON1C(=O)CCC1=O)N(c1cc(F)ccc1F)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H17F5N2O7S/c1-12(11-34-20(31)35-27-18(29)8-9-19(27)30)28(17-10-14(22)4-7-16(17)23)36(32,33)15-5-2-13(3-6-15)21(24,25)26/h2-7,10,12H,8-9,11H2,1H3/t12-/m1/s1 |
| InChIKey | QVNIJHQQCUXMFS-GFCCVEGCSA-N |
| XLogP | 3.78 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|