C14H14BF5N2 — CID 162569016
2,2-difluoro-4,6,10,12-tetramethyl-8-(trifluoromethyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 162569016) has the molecular formula C14H14BF5N2 and a molecular weight of 316.08 g/mol. Its IUPAC name is 2,2-difluoro-4,6,10,12-tetramethyl-8-(trifluoromethyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-(trifluoromethyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 162569016 |
| Molecular Formula | C14H14BF5N2 |
| Molecular Weight | 316.08 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-(trifluoromethyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=CC(C)=[N+]2C1=C(C(F)(F)F)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C14H14BF5N2/c1-7-5-9(3)21-12(7)11(14(16,17)18)13-8(2)6-10(4)22(13)15(21,19)20/h5-6H,1-4H3 |
| InChIKey | YNKHRSVZMYGURN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.08 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|