C17H21F2N7O2S — CID 162569422
N-[(3R)-3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]-3,3-difluoroazetidine-1-sulfonamide (PubChem CID 162569422) has the molecular formula C17H21F2N7O2S and a molecular weight of 425.47 g/mol. Its IUPAC name is N-[(3R)-3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]-3,3-difluoroazetidine-1-sulfonamide.
| Compound Name | N-[(3R)-3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]-3,3-difluoroazetidine-1-sulfonamide |
|---|---|
| PubChem CID | 162569422 |
| Molecular Formula | C17H21F2N7O2S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[(3R)-3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]-3,3-difluoroazetidine-1-sulfonamide |
| SMILES | CC[C@@H]1CC(NS(=O)(=O)N2CC(F)(F)C2)CC1c1nnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C17H21F2N7O2S/c1-2-10-5-11(24-29(27,28)25-8-17(18,19)9-25)6-12(10)16-23-22-14-7-21-15-13(26(14)16)3-4-20-15/h3-4,7,10-12,20,24H,2,5-6,8-9H2,1H3/t10-,11?,12?/m1/s1 |
| InChIKey | FQPDNBHZAYTJTI-VOMCLLRMSA-N |
| XLogP | 1.66 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |