C16H23F2N3 — CID 162569566
4-[4-(1,1-difluorobut-3-enyl)cyclohexa-1,3-dien-1-yl]iminohex-2-ene-1,2-diamine (PubChem CID 162569566) has the molecular formula C16H23F2N3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-[4-(1,1-difluorobut-3-enyl)cyclohexa-1,3-dien-1-yl]iminohex-2-ene-1,2-diamine.
| Compound Name | 4-[4-(1,1-difluorobut-3-enyl)cyclohexa-1,3-dien-1-yl]iminohex-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 162569566 |
| Molecular Formula | C16H23F2N3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 4-[4-(1,1-difluorobut-3-enyl)cyclohexa-1,3-dien-1-yl]iminohex-2-ene-1,2-diamine |
| SMILES | C=CCC(F)(F)C1=CC=C(/N=C(/C=C(N)CN)CC)CC1 |
| InChI | InChI=1S/C16H23F2N3/c1-3-9-16(17,18)12-5-7-15(8-6-12)21-14(4-2)10-13(20)11-19/h3,5,7,10H,1,4,6,8-9,11,19-20H2,2H3/b13-10?,21-14+ |
| InChIKey | DSYXLLXURCQTKZ-NEQPNUDBSA-N |
| XLogP | 3.45 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|