C10H13F3N2O2 — CID 162569789
2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]ethane-1,1-diol (PubChem CID 162569789) has the molecular formula C10H13F3N2O2 and a molecular weight of 250.22 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]ethane-1,1-diol.
| Compound Name | 2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 162569789 |
| Molecular Formula | C10H13F3N2O2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]ethane-1,1-diol |
| SMILES | OC(O)Cn1nc(C(F)(F)F)c2c1CCCC2 |
| InChI | InChI=1S/C10H13F3N2O2/c11-10(12,13)9-6-3-1-2-4-7(6)15(14-9)5-8(16)17/h8,16-17H,1-5H2 |
| InChIKey | JPGXUFJWOMKCRI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|