C28H38Cl2F3N5O4 — CID 162569797
ethyl 2-[4-[4-[N-[2-(3,5-dichloro-4-pyridinyl)-2-hydroxyethyl]-N-(2,2-dimethylpropyl)-N'-hydroxycarbamimidoyl]-5-(trifluoromethyl)pyrazol-1-yl]-1-methylcyclohexyl]acetate (PubChem CID 162569797) has the molecular formula C28H38Cl2F3N5O4 and a molecular weight of 636.54 g/mol. Its IUPAC name is ethyl 2-[4-[4-[N-[2-(3,5-dichloro-4-pyridinyl)-2-hydroxyethyl]-N-(2,2-dimethylpropyl)-N'-hydroxycarbamimidoyl]-5-(trifluoromethyl)pyrazol-1-yl]-1-methylcyclohexyl]acetate.
| Compound Name | ethyl 2-[4-[4-[N-[2-(3,5-dichloro-4-pyridinyl)-2-hydroxyethyl]-N-(2,2-dimethylpropyl)-N'-hydroxycarbamimidoyl]-5-(trifluoromethyl)pyrazol-1-yl]-1-methylcyclohexyl]acetate |
|---|---|
| PubChem CID | 162569797 |
| Molecular Formula | C28H38Cl2F3N5O4 |
| Molecular Weight | 636.54 g/mol |
| Exact Mass | 635.23 |
| IUPAC Name | ethyl 2-[4-[4-[N-[2-(3,5-dichloro-4-pyridinyl)-2-hydroxyethyl]-N-(2,2-dimethylpropyl)-N'-hydroxycarbamimidoyl]-5-(trifluoromethyl)pyrazol-1-yl]-1-methylcyclohexyl]acetate |
| SMILES | CCOC(=O)CC1(C)CCC(n2ncc(C(=NO)N(CC(O)c3c(Cl)cncc3Cl)CC(C)(C)C)c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C28H38Cl2F3N5O4/c1-6-42-22(40)11-27(5)9-7-17(8-10-27)38-24(28(31,32)33)18(12-35-38)25(36-41)37(16-26(2,3)4)15-21(39)23-19(29)13-34-14-20(23)30/h12-14,17,21,39,41H,6-11,15-16H2,1-5H3 |
| InChIKey | BQOMPWLXMBBTLA-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.54 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|