C12H22F3N — CID 162569961
(2S)-2-ethenyl-2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]hexan-1-amine (PubChem CID 162569961) has the molecular formula C12H22F3N and a molecular weight of 237.31 g/mol. Its IUPAC name is (2S)-2-ethenyl-2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]hexan-1-amine.
| Compound Name | (2S)-2-ethenyl-2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]hexan-1-amine |
|---|---|
| PubChem CID | 162569961 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (2S)-2-ethenyl-2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]hexan-1-amine |
| SMILES | C=C[C@](C)(CCCC)CN[C@@H](C)C(F)(F)F |
| InChI | InChI=1S/C12H22F3N/c1-5-7-8-11(4,6-2)9-16-10(3)12(13,14)15/h6,10,16H,2,5,7-9H2,1,3-4H3/t10-,11+/m0/s1 |
| InChIKey | LNHQMWJGUYDIMV-WDEREUQCSA-N |
| XLogP | 3.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|