C21H19F3N6O — CID 162569993
[(2S)-2-methyl-3-[[5-(trifluoromethyl)-2-pyridinyl]imino]piperidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone (PubChem CID 162569993) has the molecular formula C21H19F3N6O and a molecular weight of 428.42 g/mol. Its IUPAC name is [(2S)-2-methyl-3-[[5-(trifluoromethyl)-2-pyridinyl]imino]piperidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone.
| Compound Name | [(2S)-2-methyl-3-[[5-(trifluoromethyl)-2-pyridinyl]imino]piperidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 162569993 |
| Molecular Formula | C21H19F3N6O |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [(2S)-2-methyl-3-[[5-(trifluoromethyl)-2-pyridinyl]imino]piperidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone |
| SMILES | C[C@H]1/C(=N/c2ccc(C(F)(F)F)cn2)CCCN1C(=O)c1ccccc1-n1nccn1 |
| InChI | InChI=1S/C21H19F3N6O/c1-14-17(28-19-9-8-15(13-25-19)21(22,23)24)6-4-12-29(14)20(31)16-5-2-3-7-18(16)30-26-10-11-27-30/h2-3,5,7-11,13-14H,4,6,12H2,1H3/b28-17+/t14-/m0/s1 |
| InChIKey | PDKGPGOABAIUFP-YWDDKVQRSA-N |
| XLogP | 4.08 |
| TPSA | 76.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|