About 3-chlorobenzenethiol
3-chlorobenzenethiol (PubChem CID 16257) has the molecular formula C6H5ClS
and a molecular weight of 144.63 g/mol. Its IUPAC name is 3-chlorobenzenethiol.
Molecular Properties
| Compound Name | 3-chlorobenzenethiol |
| PubChem CID | 16257 |
| Molecular Formula | C6H5ClS |
| Molecular Weight | 144.63 g/mol |
| Exact Mass | 143.98 |
| IUPAC Name | 3-chlorobenzenethiol |
| SMILES | Sc1cccc(Cl)c1 |
| InChI | InChI=1S/C6H5ClS/c7-5-2-1-3-6(8)4-5/h1-4,8H |
| InChIKey | CQJDYPZUDYXHLM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.63 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzenethiol?
The IUPAC name of 3-chlorobenzenethiol (CID 16257) is 3-chlorobenzenethiol.
What is the SMILES notation for 3-chlorobenzenethiol?
The canonical SMILES for 3-chlorobenzenethiol is Sc1cccc(Cl)c1.
What is the InChIKey of 3-chlorobenzenethiol?
The InChIKey is CQJDYPZUDYXHLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClS/c7-5-2-1-3-6(8)4-5/h1-4,8H.
What are the key properties of 3-chlorobenzenethiol?
3-chlorobenzenethiol has a molecular weight of 144.63 g/mol, XLogP of 2.63, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzenethiol is sourced from PubChem (CID 16257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).