C9H8F4O2 — CID 162570031
3-fluoro-4-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 162570031) has the molecular formula C9H8F4O2 and a molecular weight of 224.15 g/mol. Its IUPAC name is 3-fluoro-4-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 3-fluoro-4-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 162570031 |
| Molecular Formula | C9H8F4O2 |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 3-fluoro-4-(2,2,2-trifluoroethoxy)cyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | O=CC1=CC(F)=C(OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H8F4O2/c10-7-3-6(4-14)1-2-8(7)15-5-9(11,12)13/h3-4H,1-2,5H2 |
| InChIKey | JROBUUYIEKAHFJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|