C14H20F6N2O4 — CID 162570044
4-O-tert-butyl 1-O-(1,1,1,4,4,4-hexafluorobutan-2-yl) piperazine-1,4-dicarboxylate (PubChem CID 162570044) has the molecular formula C14H20F6N2O4 and a molecular weight of 394.31 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-(1,1,1,4,4,4-hexafluorobutan-2-yl) piperazine-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-(1,1,1,4,4,4-hexafluorobutan-2-yl) piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 162570044 |
| Molecular Formula | C14H20F6N2O4 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 4-O-tert-butyl 1-O-(1,1,1,4,4,4-hexafluorobutan-2-yl) piperazine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(CC(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H20F6N2O4/c1-12(2,3)26-11(24)22-6-4-21(5-7-22)10(23)25-9(14(18,19)20)8-13(15,16)17/h9H,4-8H2,1-3H3 |
| InChIKey | DDZNCAUPQVTYFI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |