C24H26F3N7O4S — CID 162570239
5-[5-methyl-1-[[3-(4-methylpiperazin-1-yl)sulfonylcyclohexa-1,3-dien-1-yl]methyl]-1,2,4-triazol-3-yl]-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole (PubChem CID 162570239) has the molecular formula C24H26F3N7O4S and a molecular weight of 565.58 g/mol. Its IUPAC name is 5-[5-methyl-1-[[3-(4-methylpiperazin-1-yl)sulfonylcyclohexa-1,3-dien-1-yl]methyl]-1,2,4-triazol-3-yl]-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-[5-methyl-1-[[3-(4-methylpiperazin-1-yl)sulfonylcyclohexa-1,3-dien-1-yl]methyl]-1,2,4-triazol-3-yl]-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 162570239 |
| Molecular Formula | C24H26F3N7O4S |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | 5-[5-methyl-1-[[3-(4-methylpiperazin-1-yl)sulfonylcyclohexa-1,3-dien-1-yl]methyl]-1,2,4-triazol-3-yl]-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole |
| SMILES | Cc1nc(-c2nc(-c3ccc(OC(F)(F)F)cc3)no2)nn1CC1=CC(S(=O)(=O)N2CCN(C)CC2)=CCC1 |
| InChI | InChI=1S/C24H26F3N7O4S/c1-16-28-22(23-29-21(31-38-23)18-6-8-19(9-7-18)37-24(25,26)27)30-34(16)15-17-4-3-5-20(14-17)39(35,36)33-12-10-32(2)11-13-33/h5-9,14H,3-4,10-13,15H2,1-2H3 |
| InChIKey | ZHKNENZIBIFSDF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 119.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |