C6H7F3N2 — CID 162570291
(Z)-1,1,1-trifluorohex-3-ene-2,5-diimine (PubChem CID 162570291) has the molecular formula C6H7F3N2 and a molecular weight of 164.13 g/mol. Its IUPAC name is (Z)-1,1,1-trifluorohex-3-ene-2,5-diimine.
| Compound Name | (Z)-1,1,1-trifluorohex-3-ene-2,5-diimine |
|---|---|
| PubChem CID | 162570291 |
| Molecular Formula | C6H7F3N2 |
| Molecular Weight | 164.13 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | (Z)-1,1,1-trifluorohex-3-ene-2,5-diimine |
| SMILES | [H]/N=C(/C=C\C(C)=N\[H])C(F)(F)F |
| InChI | InChI=1S/C6H7F3N2/c1-4(10)2-3-5(11)6(7,8)9/h2-3,10-11H,1H3/b3-2-,10-4+,11-5- |
| InChIKey | BAHGTOUPIPHSKA-HZBUJCRVSA-N |
| XLogP | 2.16 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.13 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|