C26H27F3N4O2 — CID 162570396
9-methyl-7-[[5-methyl-6-(trifluoromethyl)-5,6-dihydroquinazolin-4-yl]amino]spiro[2,4-dihydrocyclohepta[c]pyridine-3,1'-cyclohexane]-1,6-dione (PubChem CID 162570396) has the molecular formula C26H27F3N4O2 and a molecular weight of 484.52 g/mol. Its IUPAC name is 9-methyl-7-[[5-methyl-6-(trifluoromethyl)-5,6-dihydroquinazolin-4-yl]amino]spiro[2,4-dihydrocyclohepta[c]pyridine-3,1'-cyclohexane]-1,6-dione.
| Compound Name | 9-methyl-7-[[5-methyl-6-(trifluoromethyl)-5,6-dihydroquinazolin-4-yl]amino]spiro[2,4-dihydrocyclohepta[c]pyridine-3,1'-cyclohexane]-1,6-dione |
|---|---|
| PubChem CID | 162570396 |
| Molecular Formula | C26H27F3N4O2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 9-methyl-7-[[5-methyl-6-(trifluoromethyl)-5,6-dihydroquinazolin-4-yl]amino]spiro[2,4-dihydrocyclohepta[c]pyridine-3,1'-cyclohexane]-1,6-dione |
| SMILES | Cc1cc(Nc2ncnc3c2C(C)C(C(F)(F)F)C=C3)c(=O)cc2c1C(=O)NC1(CCCCC1)C2 |
| InChI | InChI=1S/C26H27F3N4O2/c1-14-10-19(20(34)11-16-12-25(8-4-3-5-9-25)33-24(35)21(14)16)32-23-22-15(2)17(26(27,28)29)6-7-18(22)30-13-31-23/h6-7,10-11,13,15,17H,3-5,8-9,12H2,1-2H3,(H,33,35)(H,30,31,32,34) |
| InChIKey | IGXOMFMKCYGRDM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |