About 2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol
2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol (PubChem CID 162570733) has the molecular formula C11H17F2NO
and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol.
Molecular Properties
| Compound Name | 2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol |
| PubChem CID | 162570733 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol |
| SMILES | OCC(CC(F)F)NCC1=CCCC=C1 |
| InChI | InChI=1S/C11H17F2NO/c12-11(13)6-10(8-15)14-7-9-4-2-1-3-5-9/h2,4-5,10-11,14-15H,1,3,6-8H2 |
| InChIKey | CGQBHEYVHUXJHF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol?
The IUPAC name of 2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol (CID 162570733) is 2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol.
What is the SMILES notation for 2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol?
The canonical SMILES for 2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol is OCC(CC(F)F)NCC1=CCCC=C1.
What is the InChIKey of 2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol?
The InChIKey is CGQBHEYVHUXJHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2NO/c12-11(13)6-10(8-15)14-7-9-4-2-1-3-5-9/h2,4-5,10-11,14-15H,1,3,6-8H2.
What are the key properties of 2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol?
2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol has a molecular weight of 217.26 g/mol, XLogP of 1.87, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexa-1,5-dien-1-ylmethylamino)-4,4-difluorobutan-1-ol is sourced from PubChem (CID 162570733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).