C28H26F2N4O2 — CID 162571228
N-[[3-[4-[5-(2-cyclopropylethynyl)-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]-4-(1,1-difluoroprop-2-enyl)phenyl]methyl]-2-methylpropanamide (PubChem CID 162571228) has the molecular formula C28H26F2N4O2 and a molecular weight of 488.54 g/mol. Its IUPAC name is N-[[3-[4-[5-(2-cyclopropylethynyl)-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]-4-(1,1-difluoroprop-2-enyl)phenyl]methyl]-2-methylpropanamide.
| Compound Name | N-[[3-[4-[5-(2-cyclopropylethynyl)-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]-4-(1,1-difluoroprop-2-enyl)phenyl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 162571228 |
| Molecular Formula | C28H26F2N4O2 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | N-[[3-[4-[5-(2-cyclopropylethynyl)-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]-4-(1,1-difluoroprop-2-enyl)phenyl]methyl]-2-methylpropanamide |
| SMILES | C=CC(F)(F)c1ccc(CNC(=O)C(C)C)cc1-c1nc(-c2cncc(C#CC3CC3)c2)cc(=O)[nH]1 |
| InChI | InChI=1S/C28H26F2N4O2/c1-4-28(29,30)23-10-9-20(15-32-27(36)17(2)3)12-22(23)26-33-24(13-25(35)34-26)21-11-19(14-31-16-21)8-7-18-5-6-18/h4,9-14,16-18H,1,5-6,15H2,2-3H3,(H,32,36)(H,33,34,35) |
| InChIKey | CKQOMHNXEYDLQC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|