C14H19F2N3O — CID 162571242
(3E,5Z)-6-amino-5-[(3,3-difluorooxan-4-yl)amino]-4-methyl-2-methylidenehepta-3,5-dienenitrile (PubChem CID 162571242) has the molecular formula C14H19F2N3O and a molecular weight of 283.32 g/mol. Its IUPAC name is (3E,5Z)-6-amino-5-[(3,3-difluorooxan-4-yl)amino]-4-methyl-2-methylidenehepta-3,5-dienenitrile.
| Compound Name | (3E,5Z)-6-amino-5-[(3,3-difluorooxan-4-yl)amino]-4-methyl-2-methylidenehepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 162571242 |
| Molecular Formula | C14H19F2N3O |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (3E,5Z)-6-amino-5-[(3,3-difluorooxan-4-yl)amino]-4-methyl-2-methylidenehepta-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C(C)/C(NC1CCOCC1(F)F)=C(\C)N |
| InChI | InChI=1S/C14H19F2N3O/c1-9(7-17)6-10(2)13(11(3)18)19-12-4-5-20-8-14(12,15)16/h6,12,19H,1,4-5,8,18H2,2-3H3/b10-6+,13-11- |
| InChIKey | ATQOCOXPIPGRKY-MVEXZXKGSA-N |
| XLogP | 2.22 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|