About 6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile
6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile (PubChem CID 162571579) has the molecular formula C9H7ClF3N
and a molecular weight of 221.61 g/mol. Its IUPAC name is 6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile |
| PubChem CID | 162571579 |
| Molecular Formula | C9H7ClF3N |
| Molecular Weight | 221.61 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile |
| SMILES | CC1(Cl)C(C#N)=CC=CC1C(F)(F)F |
| InChI | InChI=1S/C9H7ClF3N/c1-8(10)6(5-14)3-2-4-7(8)9(11,12)13/h2-4,7H,1H3 |
| InChIKey | LGAMBIUKBVWZCK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.61 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile (CID 162571579) is 6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile is CC1(Cl)C(C#N)=CC=CC1C(F)(F)F.
What is the InChIKey of 6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is LGAMBIUKBVWZCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClF3N/c1-8(10)6(5-14)3-2-4-7(8)9(11,12)13/h2-4,7H,1H3.
What are the key properties of 6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile?
6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 221.61 g/mol, XLogP of 3.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-6-methyl-5-(trifluoromethyl)cyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 162571579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).