C9H8F3NO2 — CID 162571887
1-methyl-4-nitro-3-(trifluoromethyl)cyclohepta-1,3,5-triene (PubChem CID 162571887) has the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. Its IUPAC name is 1-methyl-4-nitro-3-(trifluoromethyl)cyclohepta-1,3,5-triene.
| Compound Name | 1-methyl-4-nitro-3-(trifluoromethyl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 162571887 |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 1-methyl-4-nitro-3-(trifluoromethyl)cyclohepta-1,3,5-triene |
| SMILES | CC1=CC(C(F)(F)F)=C([N+](=O)[O-])C=CC1 |
| InChI | InChI=1S/C9H8F3NO2/c1-6-3-2-4-8(13(14)15)7(5-6)9(10,11)12/h2,4-5H,3H2,1H3 |
| InChIKey | KCIHIUCTIJDHNB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|