C25H26F3N3O3 — CID 162572021
methyl 1-[(1R)-3,3-dimethyl-5-methylidenecyclohexyl]-2-[4-(trifluoromethoxy)anilino]benzimidazole-5-carboxylate (PubChem CID 162572021) has the molecular formula C25H26F3N3O3 and a molecular weight of 473.50 g/mol. Its IUPAC name is methyl 1-[(1R)-3,3-dimethyl-5-methylidenecyclohexyl]-2-[4-(trifluoromethoxy)anilino]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-[(1R)-3,3-dimethyl-5-methylidenecyclohexyl]-2-[4-(trifluoromethoxy)anilino]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 162572021 |
| Molecular Formula | C25H26F3N3O3 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | methyl 1-[(1R)-3,3-dimethyl-5-methylidenecyclohexyl]-2-[4-(trifluoromethoxy)anilino]benzimidazole-5-carboxylate |
| SMILES | C=C1C[C@H](n2c(Nc3ccc(OC(F)(F)F)cc3)nc3cc(C(=O)OC)ccc32)CC(C)(C)C1 |
| InChI | InChI=1S/C25H26F3N3O3/c1-15-11-18(14-24(2,3)13-15)31-21-10-5-16(22(32)33-4)12-20(21)30-23(31)29-17-6-8-19(9-7-17)34-25(26,27)28/h5-10,12,18H,1,11,13-14H2,2-4H3,(H,29,30)/t18-/m0/s1 |
| InChIKey | RJGSCEDLNYWMDC-SFHVURJKSA-N |
| XLogP | 6.77 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|