About (4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol
(4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol (PubChem CID 162572464) has the molecular formula C7H8F2S
and a molecular weight of 162.20 g/mol. Its IUPAC name is (4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol |
| PubChem CID | 162572464 |
| Molecular Formula | C7H8F2S |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | (4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol |
| SMILES | FC1(F)C=CC(CS)=CC1 |
| InChI | InChI=1S/C7H8F2S/c8-7(9)3-1-6(5-10)2-4-7/h1-3,10H,4-5H2 |
| InChIKey | LDDJDJBYIMUBTL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol?
The IUPAC name of (4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol (CID 162572464) is (4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol.
What is the SMILES notation for (4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol?
The canonical SMILES for (4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol is FC1(F)C=CC(CS)=CC1.
What is the InChIKey of (4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol?
The InChIKey is LDDJDJBYIMUBTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2S/c8-7(9)3-1-6(5-10)2-4-7/h1-3,10H,4-5H2.
What are the key properties of (4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol?
(4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol has a molecular weight of 162.20 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexa-1,5-dien-1-yl)methanethiol is sourced from PubChem (CID 162572464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).