C19H27F3N2O — CID 162572553
(3Z)-6-N-(2-ethoxyethyl)-5-methylidene-6-N-[(2E)-penta-2,4-dien-2-yl]-2-N-(2,2,2-trifluoroethyl)hepta-1,3,6-triene-2,6-diamine (PubChem CID 162572553) has the molecular formula C19H27F3N2O and a molecular weight of 356.43 g/mol. Its IUPAC name is (3Z)-6-N-(2-ethoxyethyl)-5-methylidene-6-N-[(2E)-penta-2,4-dien-2-yl]-2-N-(2,2,2-trifluoroethyl)hepta-1,3,6-triene-2,6-diamine.
| Compound Name | (3Z)-6-N-(2-ethoxyethyl)-5-methylidene-6-N-[(2E)-penta-2,4-dien-2-yl]-2-N-(2,2,2-trifluoroethyl)hepta-1,3,6-triene-2,6-diamine |
|---|---|
| PubChem CID | 162572553 |
| Molecular Formula | C19H27F3N2O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (3Z)-6-N-(2-ethoxyethyl)-5-methylidene-6-N-[(2E)-penta-2,4-dien-2-yl]-2-N-(2,2,2-trifluoroethyl)hepta-1,3,6-triene-2,6-diamine |
| SMILES | C=C/C=C(\C)N(CCOCC)C(=C)C(=C)/C=C\C(=C)NCC(F)(F)F |
| InChI | InChI=1S/C19H27F3N2O/c1-7-9-17(5)24(12-13-25-8-2)18(6)15(3)10-11-16(4)23-14-19(20,21)22/h7,9-11,23H,1,3-4,6,8,12-14H2,2,5H3/b11-10-,17-9+ |
| InChIKey | BCRZNWHVHCFTKS-WZPXUMEWSA-N |
| XLogP | 4.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|