C16H12F4N2O3S — CID 162572590
4-hydroxy-4-pyrimidin-2-yl-1-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-6-yl)butan-1-one (PubChem CID 162572590) has the molecular formula C16H12F4N2O3S and a molecular weight of 388.34 g/mol. Its IUPAC name is 4-hydroxy-4-pyrimidin-2-yl-1-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-6-yl)butan-1-one.
| Compound Name | 4-hydroxy-4-pyrimidin-2-yl-1-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-6-yl)butan-1-one |
|---|---|
| PubChem CID | 162572590 |
| Molecular Formula | C16H12F4N2O3S |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 4-hydroxy-4-pyrimidin-2-yl-1-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-6-yl)butan-1-one |
| SMILES | O=C(CCC(O)c1ncccn1)c1ccc2c(c1)SC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C16H12F4N2O3S/c17-15(18)16(19,20)26-13-8-9(2-5-12(13)25-15)10(23)3-4-11(24)14-21-6-1-7-22-14/h1-2,5-8,11,24H,3-4H2 |
| InChIKey | MXJXFAPCYQWAMU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|