C35H49F2O7S2+ — CID 162572724
1,1-difluoro-2-[[2-[4-[2-[4-(2-methylpropyl)phenyl]-1-(1,4-oxathian-4-ium-4-yl)-2-oxoethyl]cyclohexyl]-1-adamantyl]methoxy]-2-oxoethanesulfonic acid (PubChem CID 162572724) has the molecular formula C35H49F2O7S2+ and a molecular weight of 683.90 g/mol. Its IUPAC name is 1,1-difluoro-2-[[2-[4-[2-[4-(2-methylpropyl)phenyl]-1-(1,4-oxathian-4-ium-4-yl)-2-oxoethyl]cyclohexyl]-1-adamantyl]methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[2-[4-[2-[4-(2-methylpropyl)phenyl]-1-(1,4-oxathian-4-ium-4-yl)-2-oxoethyl]cyclohexyl]-1-adamantyl]methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 162572724 |
| Molecular Formula | C35H49F2O7S2+ |
| Molecular Weight | 683.90 g/mol |
| Exact Mass | 683.29 |
| IUPAC Name | 1,1-difluoro-2-[[2-[4-[2-[4-(2-methylpropyl)phenyl]-1-(1,4-oxathian-4-ium-4-yl)-2-oxoethyl]cyclohexyl]-1-adamantyl]methoxy]-2-oxoethanesulfonic acid |
| SMILES | CC(C)Cc1ccc(C(=O)C(C2CCC(C3C4CC5CC(C4)CC3(COC(=O)C(F)(F)S(=O)(=O)O)C5)CC2)[S+]2CCOCC2)cc1 |
| InChI | InChI=1S/C35H48F2O7S2/c1-22(2)15-23-3-5-27(6-4-23)31(38)32(45-13-11-43-12-14-45)28-9-7-26(8-10-28)30-29-17-24-16-25(18-29)20-34(30,19-24)21-44-33(39)35(36,37)46(40,41)42/h3-6,22,24-26,28-30,32H,7-21H2,1-2H3/p+1 |
| InChIKey | LTUMWWYBUXRGKB-UHFFFAOYSA-O |
| XLogP | 6.36 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.90 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|