C30H43F2NO6S2 — CID 162572749
[4-[2-(4-ethoxycarbonylthiomorpholin-1-ium-1-yl)-3-oxo-3-(4-propan-2-ylphenyl)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-difluoromethanesulfonate (PubChem CID 162572749) has the molecular formula C30H43F2NO6S2 and a molecular weight of 615.81 g/mol. Its IUPAC name is [4-[2-(4-ethoxycarbonylthiomorpholin-1-ium-1-yl)-3-oxo-3-(4-propan-2-ylphenyl)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-difluoromethanesulfonate.
| Compound Name | [4-[2-(4-ethoxycarbonylthiomorpholin-1-ium-1-yl)-3-oxo-3-(4-propan-2-ylphenyl)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-difluoromethanesulfonate |
|---|---|
| PubChem CID | 162572749 |
| Molecular Formula | C30H43F2NO6S2 |
| Molecular Weight | 615.81 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | [4-[2-(4-ethoxycarbonylthiomorpholin-1-ium-1-yl)-3-oxo-3-(4-propan-2-ylphenyl)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-difluoromethanesulfonate |
| SMILES | CCOC(=O)N1CC[S+](C(CC2CC(C(F)(F)S(=O)(=O)[O-])CC3CCCCC32)C(=O)c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C30H43F2NO6S2/c1-4-39-29(35)33-13-15-40(16-14-33)27(28(34)22-11-9-21(10-12-22)20(2)3)19-24-18-25(30(31,32)41(36,37)38)17-23-7-5-6-8-26(23)24/h9-12,20,23-27H,4-8,13-19H2,1-3H3 |
| InChIKey | MFXPJHCOKSIYLY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.81 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|