C20H16F4N2 — CID 162573408
12,12,13,13-tetrafluoro-6,9,17-trimethyl-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1,3,5,7,10,14(18),15-heptaene (PubChem CID 162573408) has the molecular formula C20H16F4N2 and a molecular weight of 360.35 g/mol. Its IUPAC name is 12,12,13,13-tetrafluoro-6,9,17-trimethyl-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1,3,5,7,10,14(18),15-heptaene.
| Compound Name | 12,12,13,13-tetrafluoro-6,9,17-trimethyl-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1,3,5,7,10,14(18),15-heptaene |
|---|---|
| PubChem CID | 162573408 |
| Molecular Formula | C20H16F4N2 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 12,12,13,13-tetrafluoro-6,9,17-trimethyl-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1,3,5,7,10,14(18),15-heptaene |
| SMILES | Cc1cccc2c1=C1N(C)C=C3N1C1=C(C=CC(C)C=21)C(F)(F)C3(F)F |
| InChI | InChI=1S/C20H16F4N2/c1-10-5-4-6-12-15-11(2)7-8-13-17(15)26-14(20(23,24)19(13,21)22)9-25(3)18(26)16(10)12/h4-9,11H,1-3H3 |
| InChIKey | VRQYGJQLIHRPTL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|