C24H22F6N2 — CID 162573410
6,9,13,13,17-pentamethyl-12,12-bis(trifluoromethyl)-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1,3,5,7,10,14,16-heptaene (PubChem CID 162573410) has the molecular formula C24H22F6N2 and a molecular weight of 452.44 g/mol. Its IUPAC name is 6,9,13,13,17-pentamethyl-12,12-bis(trifluoromethyl)-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1,3,5,7,10,14,16-heptaene.
| Compound Name | 6,9,13,13,17-pentamethyl-12,12-bis(trifluoromethyl)-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1,3,5,7,10,14,16-heptaene |
|---|---|
| PubChem CID | 162573410 |
| Molecular Formula | C24H22F6N2 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 6,9,13,13,17-pentamethyl-12,12-bis(trifluoromethyl)-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1,3,5,7,10,14,16-heptaene |
| SMILES | CC1=CC=C2C3C1=c1cccc(C)c1=C1N(C)C=C(N13)C(C(F)(F)F)(C(F)(F)F)C2(C)C |
| InChI | InChI=1S/C24H22F6N2/c1-12-7-6-8-14-17-13(2)9-10-15-19(17)32-16(11-31(5)20(32)18(12)14)22(21(15,3)4,23(25,26)27)24(28,29)30/h6-11,19H,1-5H3 |
| InChIKey | BRRUFVGWIWQPOT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |