About 6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane
6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane (PubChem CID 162573535) has the molecular formula C11H17F3
and a molecular weight of 206.25 g/mol. Its IUPAC name is 6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | 6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane |
| PubChem CID | 162573535 |
| Molecular Formula | C11H17F3 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane |
| SMILES | CC(CCC1C2CCCC21)C(F)(F)F |
| InChI | InChI=1S/C11H17F3/c1-7(11(12,13)14)5-6-10-8-3-2-4-9(8)10/h7-10H,2-6H2,1H3 |
| InChIKey | FHCVGPKRJAGDOJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane?
The IUPAC name of 6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane (CID 162573535) is 6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane.
What is the SMILES notation for 6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane?
The canonical SMILES for 6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane is CC(CCC1C2CCCC21)C(F)(F)F.
What is the InChIKey of 6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane?
The InChIKey is FHCVGPKRJAGDOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3/c1-7(11(12,13)14)5-6-10-8-3-2-4-9(8)10/h7-10H,2-6H2,1H3.
What are the key properties of 6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane?
6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane has a molecular weight of 206.25 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,4,4-trifluoro-3-methylbutyl)bicyclo[3.1.0]hexane is sourced from PubChem (CID 162573535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).