C27H28F6N6O — CID 162574106
6-[(2R)-2,4-dimethylpiperazin-1-yl]-4-(trifluoromethyl)-2-[3-[(2R)-1,1,2-trifluoro-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-3H-isoindol-1-one (PubChem CID 162574106) has the molecular formula C27H28F6N6O and a molecular weight of 566.55 g/mol. Its IUPAC name is 6-[(2R)-2,4-dimethylpiperazin-1-yl]-4-(trifluoromethyl)-2-[3-[(2R)-1,1,2-trifluoro-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-3H-isoindol-1-one.
| Compound Name | 6-[(2R)-2,4-dimethylpiperazin-1-yl]-4-(trifluoromethyl)-2-[3-[(2R)-1,1,2-trifluoro-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 162574106 |
| Molecular Formula | C27H28F6N6O |
| Molecular Weight | 566.55 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 6-[(2R)-2,4-dimethylpiperazin-1-yl]-4-(trifluoromethyl)-2-[3-[(2R)-1,1,2-trifluoro-1-(4-methyl-1,2,4-triazol-3-yl)propan-2-yl]phenyl]-3H-isoindol-1-one |
| SMILES | C[C@@H]1CN(C)CCN1c1cc2c(c(C(F)(F)F)c1)CN(c1cccc([C@@](C)(F)C(F)(F)c3nncn3C)c1)C2=O |
| InChI | InChI=1S/C27H28F6N6O/c1-16-13-36(3)8-9-38(16)19-11-20-21(22(12-19)27(31,32)33)14-39(23(20)40)18-7-5-6-17(10-18)25(2,28)26(29,30)24-35-34-15-37(24)4/h5-7,10-12,15-16H,8-9,13-14H2,1-4H3/t16-,25-/m1/s1 |
| InChIKey | NSLPTCCCQMTGGM-PUAOIOHZSA-N |
| XLogP | 5.11 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |