C10H12F3NOSi — CID 162574233
3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydro-1,3-benzazasilole (PubChem CID 162574233) has the molecular formula C10H12F3NOSi and a molecular weight of 247.29 g/mol. Its IUPAC name is 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydro-1,3-benzazasilole.
| Compound Name | 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydro-1,3-benzazasilole |
|---|---|
| PubChem CID | 162574233 |
| Molecular Formula | C10H12F3NOSi |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 3,3-dimethyl-5-(trifluoromethoxy)-1,2-dihydro-1,3-benzazasilole |
| SMILES | C[Si]1(C)CNc2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C10H12F3NOSi/c1-16(2)6-14-8-4-3-7(5-9(8)16)15-10(11,12)13/h3-5,14H,6H2,1-2H3 |
| InChIKey | DEZYJVXNPHTEGW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|