C21H28F3N3O6 — CID 162574474
(2,5-dioxopyrrolidin-1-yl) 4-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3,3-dimethylbutanoate (PubChem CID 162574474) has the molecular formula C21H28F3N3O6 and a molecular weight of 475.46 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3,3-dimethylbutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 162574474 |
| Molecular Formula | C21H28F3N3O6 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3,3-dimethylbutanoate |
| SMILES | CC(C)(CNC(CCCCCN1C(=O)C=CC1=O)C(F)(F)F)CC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C21H28F3N3O6/c1-20(2,12-19(32)33-27-17(30)9-10-18(27)31)13-25-14(21(22,23)24)6-4-3-5-11-26-15(28)7-8-16(26)29/h7-8,14,25H,3-6,9-13H2,1-2H3 |
| InChIKey | IMXZIZGDYMGOSJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|