About piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone
piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone (PubChem CID 162574734) has the molecular formula C13H15F3N2O
and a molecular weight of 272.27 g/mol. Its IUPAC name is piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone.
Molecular Properties
| Compound Name | piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone |
| PubChem CID | 162574734 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone |
| SMILES | O=C(C1=C(C(F)(F)F)C=CCC=C1)N1CCNCC1 |
| InChI | InChI=1S/C13H15F3N2O/c14-13(15,16)11-5-3-1-2-4-10(11)12(19)18-8-6-17-7-9-18/h2-5,17H,1,6-9H2 |
| InChIKey | VKZJRWXMSVVZMQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone?
The IUPAC name of piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone (CID 162574734) is piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone.
What is the SMILES notation for piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone?
The canonical SMILES for piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone is O=C(C1=C(C(F)(F)F)C=CCC=C1)N1CCNCC1.
What is the InChIKey of piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone?
The InChIKey is VKZJRWXMSVVZMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3N2O/c14-13(15,16)11-5-3-1-2-4-10(11)12(19)18-8-6-17-7-9-18/h2-5,17H,1,6-9H2.
What are the key properties of piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone?
piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone has a molecular weight of 272.27 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperazin-1-yl-[2-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methanone is sourced from PubChem (CID 162574734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).