C15H19F2N — CID 162574990
(3E,4Z,8E)-7,7-difluoro-6-methylidene-3-(2-methylprop-2-enylidene)deca-4,8-dien-2-imine (PubChem CID 162574990) has the molecular formula C15H19F2N and a molecular weight of 251.32 g/mol. Its IUPAC name is (3E,4Z,8E)-7,7-difluoro-6-methylidene-3-(2-methylprop-2-enylidene)deca-4,8-dien-2-imine.
| Compound Name | (3E,4Z,8E)-7,7-difluoro-6-methylidene-3-(2-methylprop-2-enylidene)deca-4,8-dien-2-imine |
|---|---|
| PubChem CID | 162574990 |
| Molecular Formula | C15H19F2N |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (3E,4Z,8E)-7,7-difluoro-6-methylidene-3-(2-methylprop-2-enylidene)deca-4,8-dien-2-imine |
| SMILES | [H]/N=C(C)/C(/C=C\C(=C)C(F)(F)/C=C/C)=C/C(=C)C |
| InChI | InChI=1S/C15H19F2N/c1-6-9-15(16,17)12(4)7-8-14(13(5)18)10-11(2)3/h6-10,18H,2,4H2,1,3,5H3/b8-7-,9-6+,14-10+,18-13+ |
| InChIKey | ZAAAEOKFCIPMDA-TWPQYKNESA-N |
| XLogP | 4.85 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|