C16H11F4N — CID 162575710
10-fluoro-8-(trifluoromethyl)-1-azatetracyclo[10.4.0.02,5.06,11]hexadeca-3,7,9,11,13,15-hexaene (PubChem CID 162575710) has the molecular formula C16H11F4N and a molecular weight of 293.26 g/mol. Its IUPAC name is 10-fluoro-8-(trifluoromethyl)-1-azatetracyclo[10.4.0.02,5.06,11]hexadeca-3,7,9,11,13,15-hexaene.
| Compound Name | 10-fluoro-8-(trifluoromethyl)-1-azatetracyclo[10.4.0.02,5.06,11]hexadeca-3,7,9,11,13,15-hexaene |
|---|---|
| PubChem CID | 162575710 |
| Molecular Formula | C16H11F4N |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 10-fluoro-8-(trifluoromethyl)-1-azatetracyclo[10.4.0.02,5.06,11]hexadeca-3,7,9,11,13,15-hexaene |
| SMILES | FC1=CC(C(F)(F)F)=CC2C1=C1C=CC=CN1C1C=CC21 |
| InChI | InChI=1S/C16H11F4N/c17-12-8-9(16(18,19)20)7-11-10-4-5-13(10)21-6-2-1-3-14(21)15(11)12/h1-8,10-11,13H |
| InChIKey | TXXUYWHCSSYJOO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|