C15H15F5O2 — CID 162576017
[3,5-difluoro-4-[(2E,4Z)-6-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxycyclohexa-1,5-dien-1-yl]methanol (PubChem CID 162576017) has the molecular formula C15H15F5O2 and a molecular weight of 322.27 g/mol. Its IUPAC name is [3,5-difluoro-4-[(2E,4Z)-6-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxycyclohexa-1,5-dien-1-yl]methanol.
| Compound Name | [3,5-difluoro-4-[(2E,4Z)-6-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxycyclohexa-1,5-dien-1-yl]methanol |
|---|---|
| PubChem CID | 162576017 |
| Molecular Formula | C15H15F5O2 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [3,5-difluoro-4-[(2E,4Z)-6-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxycyclohexa-1,5-dien-1-yl]methanol |
| SMILES | C=C(/C=C\C(=C/C)OC1C(F)=CC(CO)=CC1F)C(F)(F)F |
| InChI | InChI=1S/C15H15F5O2/c1-3-11(5-4-9(2)15(18,19)20)22-14-12(16)6-10(8-21)7-13(14)17/h3-7,12,14,21H,2,8H2,1H3/b5-4-,11-3+ |
| InChIKey | HODFARDJVVANGB-NEPXUXLISA-N |
| XLogP | 4.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|