C11H11F3 — CID 162576460
[(2R)-1,1,1-trifluoro-3-methylbut-3-en-2-yl]benzene (PubChem CID 162576460) has the molecular formula C11H11F3 and a molecular weight of 200.20 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluoro-3-methylbut-3-en-2-yl]benzene.
| Compound Name | [(2R)-1,1,1-trifluoro-3-methylbut-3-en-2-yl]benzene |
|---|---|
| PubChem CID | 162576460 |
| Molecular Formula | C11H11F3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | [(2R)-1,1,1-trifluoro-3-methylbut-3-en-2-yl]benzene |
| SMILES | C=C(C)[C@H](c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3/c1-8(2)10(11(12,13)14)9-6-4-3-5-7-9/h3-7,10H,1H2,2H3/t10-/m1/s1 |
| InChIKey | SIODSZFQGLDPQK-SNVBAGLBSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|