C10H8F6 — CID 162576507
1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 162576507) has the molecular formula C10H8F6 and a molecular weight of 242.16 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 162576507 |
| Molecular Formula | C10H8F6 |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | FC(F)(F)CC12C=CC(C1)C(C(F)(F)F)=C2 |
| InChI | InChI=1S/C10H8F6/c11-9(12,13)5-8-2-1-6(3-8)7(4-8)10(14,15)16/h1-2,4,6H,3,5H2 |
| InChIKey | GZOYQKGILWKNNU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|