C27H32F3N7 — CID 162576723
N-[[4-[2-[amino-(2-aminohydrazinyl)-cyclobutylmethyl]phenyl]phenyl]methyl]-2-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 162576723) has the molecular formula C27H32F3N7 and a molecular weight of 511.60 g/mol. Its IUPAC name is N-[[4-[2-[amino-(2-aminohydrazinyl)-cyclobutylmethyl]phenyl]phenyl]methyl]-2-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | N-[[4-[2-[amino-(2-aminohydrazinyl)-cyclobutylmethyl]phenyl]phenyl]methyl]-2-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 162576723 |
| Molecular Formula | C27H32F3N7 |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | N-[[4-[2-[amino-(2-aminohydrazinyl)-cyclobutylmethyl]phenyl]phenyl]methyl]-2-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | NNNC(N)(c1ccccc1-c1ccc(CNc2nc(C(F)(F)F)nc3c2CCCC3)cc1)C1CCC1 |
| InChI | InChI=1S/C27H32F3N7/c28-27(29,30)25-34-23-11-4-2-9-21(23)24(35-25)33-16-17-12-14-18(15-13-17)20-8-1-3-10-22(20)26(31,36-37-32)19-6-5-7-19/h1,3,8,10,12-15,19,36-37H,2,4-7,9,11,16,31-32H2,(H,33,34,35) |
| InChIKey | JUCUMELVNKELMH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|